C11H14BrNO2 — CID 106672210
1-[(2-bromophenyl)methyl]pyrrolidine-3,4-diol (PubChem CID 106672210) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(2-bromophenyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672210 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]pyrrolidine-3,4-diol |
| SMILES | OC1CN(Cc2ccccc2Br)CC1O |
| InChI | InChI=1S/C11H14BrNO2/c12-9-4-2-1-3-8(9)5-13-6-10(14)11(15)7-13/h1-4,10-11,14-15H,5-7H2 |
| InChIKey | WOAFHTCBMYPYFD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |