C18H28FN5OS — CID 9217963
2-[4-[3-(dimethylamino)propylcarbamothioyl]piperazin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 9217963) has the molecular formula C18H28FN5OS and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[4-[3-(dimethylamino)propylcarbamothioyl]piperazin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[3-(dimethylamino)propylcarbamothioyl]piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9217963 |
| Molecular Formula | C18H28FN5OS |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-[4-[3-(dimethylamino)propylcarbamothioyl]piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CN(C)CCCNC(=S)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H28FN5OS/c1-22(2)9-3-8-20-18(26)24-12-10-23(11-13-24)14-17(25)21-16-6-4-15(19)5-7-16/h4-7H,3,8-14H2,1-2H3,(H,20,26)(H,21,25) |
| InChIKey | RYLFXSFBKXUPQD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|