C20H31FN4O2 — CID 8804929
2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-hexylacetamide (PubChem CID 8804929) has the molecular formula C20H31FN4O2 and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-hexylacetamide.
| Compound Name | 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-hexylacetamide |
|---|---|
| PubChem CID | 8804929 |
| Molecular Formula | C20H31FN4O2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CN1CCN(CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H31FN4O2/c1-2-3-4-5-10-22-19(26)15-24-11-13-25(14-12-24)16-20(27)23-18-8-6-17(21)7-9-18/h6-9H,2-5,10-16H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | UBXOMHGNDMNXSS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|