C29H48N6O6 — CID 171639410
2-[4-(carboxymethyl)-10-ethyl-7-[2-[4-(hexylcarbamoyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171639410) has the molecular formula C29H48N6O6 and a molecular weight of 576.74 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-10-ethyl-7-[2-[4-(hexylcarbamoyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-10-ethyl-7-[2-[4-(hexylcarbamoyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171639410 |
| Molecular Formula | C29H48N6O6 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | 2-[4-(carboxymethyl)-10-ethyl-7-[2-[4-(hexylcarbamoyl)anilino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCCCCNC(=O)c1ccc(NC(=O)CN2CCN(CC)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C29H48N6O6/c1-3-5-6-7-12-30-29(41)24-8-10-25(11-9-24)31-26(36)21-33-15-13-32(4-2)14-16-34(22-27(37)38)19-20-35(18-17-33)23-28(39)40/h8-11H,3-7,12-23H2,1-2H3,(H,30,41)(H,31,36)(H,37,38)(H,39,40) |
| InChIKey | HOOVFLUYPYCQJW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|