C25H31N5S — CID 19289419
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide (PubChem CID 19289419) has the molecular formula C25H31N5S and a molecular weight of 433.63 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289419 |
| Molecular Formula | C25H31N5S |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(CN2CCN(C(=S)Nc3c(C)nn(Cc4ccccc4)c3C)CC2)cc1 |
| InChI | InChI=1S/C25H31N5S/c1-19-9-11-23(12-10-19)17-28-13-15-29(16-14-28)25(31)26-24-20(2)27-30(21(24)3)18-22-7-5-4-6-8-22/h4-12H,13-18H2,1-3H3,(H,26,31) |
| InChIKey | AGQFDUAQGFOHLT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|