C16H20FN3 — CID 56982556
4-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]-1-methylpiperidine (PubChem CID 56982556) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]-1-methylpiperidine.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 56982556 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]imidazol-2-yl]-1-methylpiperidine |
| SMILES | CN1CCC(c2nccn2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H20FN3/c1-19-9-6-14(7-10-19)16-18-8-11-20(16)12-13-2-4-15(17)5-3-13/h2-5,8,11,14H,6-7,9-10,12H2,1H3 |
| InChIKey | GLJPTXXQZDBFGH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |