C15H23N5 — CID 56861899
1-methyl-4-[1-[2-(2-methylimidazol-1-yl)ethyl]imidazol-2-yl]piperidine (PubChem CID 56861899) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-methyl-4-[1-[2-(2-methylimidazol-1-yl)ethyl]imidazol-2-yl]piperidine.
| Compound Name | 1-methyl-4-[1-[2-(2-methylimidazol-1-yl)ethyl]imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 56861899 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 1-methyl-4-[1-[2-(2-methylimidazol-1-yl)ethyl]imidazol-2-yl]piperidine |
| SMILES | Cc1nccn1CCn1ccnc1C1CCN(C)CC1 |
| InChI | InChI=1S/C15H23N5/c1-13-16-5-9-19(13)11-12-20-10-6-17-15(20)14-3-7-18(2)8-4-14/h5-6,9-10,14H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | KAQZFUGGXAAYPF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |