C28H34N4S — CID 3802814
N-(2,3-dihydro-1H-inden-5-yl)-4-[1-[(4-propan-2-ylphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide (PubChem CID 3802814) has the molecular formula C28H34N4S and a molecular weight of 458.68 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-4-[1-[(4-propan-2-ylphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-4-[1-[(4-propan-2-ylphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3802814 |
| Molecular Formula | C28H34N4S |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-4-[1-[(4-propan-2-ylphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide |
| SMILES | CC(C)c1ccc(Cn2ccnc2C2CCN(C(=S)Nc3ccc4c(c3)CCC4)CC2)cc1 |
| InChI | InChI=1S/C28H34N4S/c1-20(2)22-8-6-21(7-9-22)19-32-17-14-29-27(32)24-12-15-31(16-13-24)28(33)30-26-11-10-23-4-3-5-25(23)18-26/h6-11,14,17-18,20,24H,3-5,12-13,15-16,19H2,1-2H3,(H,30,33) |
| InChIKey | VETZZJVUEWPHBU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|