C25H34N4S2 — CID 3806297
N-(1-adamantyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide (PubChem CID 3806297) has the molecular formula C25H34N4S2 and a molecular weight of 454.71 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-(1-adamantyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3806297 |
| Molecular Formula | C25H34N4S2 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-(1-adamantyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide |
| SMILES | S=C(NC12CC3CC(CC(C3)C1)C2)N1CCC(c2nccn2CCc2ccsc2)CC1 |
| InChI | InChI=1S/C25H34N4S2/c30-24(27-25-14-19-11-20(15-25)13-21(12-19)16-25)29-7-2-22(3-8-29)23-26-5-9-28(23)6-1-18-4-10-31-17-18/h4-5,9-10,17,19-22H,1-3,6-8,11-16H2,(H,27,30) |
| InChIKey | JUJUIROXEKZPNF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|