C11H15N3S — CID 106567554
N-ethyl-1-(2-thiophen-3-ylethyl)imidazol-2-amine (PubChem CID 106567554) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N-ethyl-1-(2-thiophen-3-ylethyl)imidazol-2-amine.
| Compound Name | N-ethyl-1-(2-thiophen-3-ylethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106567554 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-ethyl-1-(2-thiophen-3-ylethyl)imidazol-2-amine |
| SMILES | CCNc1nccn1CCc1ccsc1 |
| InChI | InChI=1S/C11H15N3S/c1-2-12-11-13-5-7-14(11)6-3-10-4-8-15-9-10/h4-5,7-9H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | VEDALQYBGJRMFN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |