C19H27N3OS — CID 72854193
1-[4-(1-butylimidazol-2-yl)piperidin-1-yl]-3-thiophen-2-ylpropan-1-one (PubChem CID 72854193) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 1-[4-(1-butylimidazol-2-yl)piperidin-1-yl]-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[4-(1-butylimidazol-2-yl)piperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 72854193 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[4-(1-butylimidazol-2-yl)piperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
| SMILES | CCCCn1ccnc1C1CCN(C(=O)CCc2cccs2)CC1 |
| InChI | InChI=1S/C19H27N3OS/c1-2-3-11-22-14-10-20-19(22)16-8-12-21(13-9-16)18(23)7-6-17-5-4-15-24-17/h4-5,10,14-16H,2-3,6-9,11-13H2,1H3 |
| InChIKey | HPHJTOXOGKZPGM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |