C13H16N2O2S2 — CID 4669279
ethyl 3-(1,3-thiazolidine-3-carbothioylamino)benzoate (PubChem CID 4669279) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is ethyl 3-(1,3-thiazolidine-3-carbothioylamino)benzoate.
| Compound Name | ethyl 3-(1,3-thiazolidine-3-carbothioylamino)benzoate |
|---|---|
| PubChem CID | 4669279 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | ethyl 3-(1,3-thiazolidine-3-carbothioylamino)benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)N2CCSC2)c1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-2-17-12(16)10-4-3-5-11(8-10)14-13(18)15-6-7-19-9-15/h3-5,8H,2,6-7,9H2,1H3,(H,14,18) |
| InChIKey | FUWVRUPNLAAEKU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|