C22H27N3O2S — CID 100623987
ethyl 3-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzoate (PubChem CID 100623987) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is ethyl 3-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzoate.
| Compound Name | ethyl 3-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100623987 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl 3-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NCc2ccc(N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-2-27-21(26)18-7-6-8-19(15-18)24-22(28)23-16-17-9-11-20(12-10-17)25-13-4-3-5-14-25/h6-12,15H,2-5,13-14,16H2,1H3,(H2,23,24,28) |
| InChIKey | JXBOGKSWNSTZJR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|