C22H27N3OS — CID 100624256
1-[(4-piperidin-1-ylphenyl)methyl]-3-(3-prop-2-enoxyphenyl)thiourea (PubChem CID 100624256) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-[(4-piperidin-1-ylphenyl)methyl]-3-(3-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[(4-piperidin-1-ylphenyl)methyl]-3-(3-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100624256 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[(4-piperidin-1-ylphenyl)methyl]-3-(3-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cccc(NC(=S)NCc2ccc(N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H27N3OS/c1-2-15-26-21-8-6-7-19(16-21)24-22(27)23-17-18-9-11-20(12-10-18)25-13-4-3-5-14-25/h2,6-12,16H,1,3-5,13-15,17H2,(H2,23,24,27) |
| InChIKey | IFQFLGPXEIWPJZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|