C22H28N4OS — CID 100624395
N,N-dimethyl-4-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzamide (PubChem CID 100624395) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is N,N-dimethyl-4-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzamide.
| Compound Name | N,N-dimethyl-4-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 100624395 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N,N-dimethyl-4-[(4-piperidin-1-ylphenyl)methylcarbamothioylamino]benzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=S)NCc2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H28N4OS/c1-25(2)21(27)18-8-10-19(11-9-18)24-22(28)23-16-17-6-12-20(13-7-17)26-14-4-3-5-15-26/h6-13H,3-5,14-16H2,1-2H3,(H2,23,24,28) |
| InChIKey | JRHQHWQQDWZWCP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|