C19H22FN3S2 — CID 4097934
3-[(4-fluorophenyl)methyl]-N-(3-methylsulfanylphenyl)-1,3-diazinane-1-carbothioamide (PubChem CID 4097934) has the molecular formula C19H22FN3S2 and a molecular weight of 375.54 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-N-(3-methylsulfanylphenyl)-1,3-diazinane-1-carbothioamide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-N-(3-methylsulfanylphenyl)-1,3-diazinane-1-carbothioamide |
|---|---|
| PubChem CID | 4097934 |
| Molecular Formula | C19H22FN3S2 |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-N-(3-methylsulfanylphenyl)-1,3-diazinane-1-carbothioamide |
| SMILES | CSc1cccc(NC(=S)N2CCCN(Cc3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C19H22FN3S2/c1-25-18-5-2-4-17(12-18)21-19(24)23-11-3-10-22(14-23)13-15-6-8-16(20)9-7-15/h2,4-9,12H,3,10-11,13-14H2,1H3,(H,21,24) |
| InChIKey | PFLGULRHQNYPMN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|