C21H26FN3S — CID 4095879
3-[(4-fluorophenyl)methyl]-N-(2,4,6-trimethylphenyl)-1,3-diazinane-1-carbothioamide (PubChem CID 4095879) has the molecular formula C21H26FN3S and a molecular weight of 371.53 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-N-(2,4,6-trimethylphenyl)-1,3-diazinane-1-carbothioamide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-N-(2,4,6-trimethylphenyl)-1,3-diazinane-1-carbothioamide |
|---|---|
| PubChem CID | 4095879 |
| Molecular Formula | C21H26FN3S |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-N-(2,4,6-trimethylphenyl)-1,3-diazinane-1-carbothioamide |
| SMILES | Cc1cc(C)c(NC(=S)N2CCCN(Cc3ccc(F)cc3)C2)c(C)c1 |
| InChI | InChI=1S/C21H26FN3S/c1-15-11-16(2)20(17(3)12-15)23-21(26)25-10-4-9-24(14-25)13-18-5-7-19(22)8-6-18/h5-8,11-12H,4,9-10,13-14H2,1-3H3,(H,23,26) |
| InChIKey | KKRSQMWWTZWPOV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|