C20H34N3S+ — CID 3503485
butan-2-yl-methyl-[1-[(2,4,6-trimethylphenyl)carbamothioyl]piperidin-4-yl]azanium (PubChem CID 3503485) has the molecular formula C20H34N3S+ and a molecular weight of 348.58 g/mol. Its IUPAC name is butan-2-yl-methyl-[1-[(2,4,6-trimethylphenyl)carbamothioyl]piperidin-4-yl]azanium.
| Compound Name | butan-2-yl-methyl-[1-[(2,4,6-trimethylphenyl)carbamothioyl]piperidin-4-yl]azanium |
|---|---|
| PubChem CID | 3503485 |
| Molecular Formula | C20H34N3S+ |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | butan-2-yl-methyl-[1-[(2,4,6-trimethylphenyl)carbamothioyl]piperidin-4-yl]azanium |
| SMILES | CCC(C)[NH+](C)C1CCN(C(=S)Nc2c(C)cc(C)cc2C)CC1 |
| InChI | InChI=1S/C20H33N3S/c1-7-17(5)22(6)18-8-10-23(11-9-18)20(24)21-19-15(3)12-14(2)13-16(19)4/h12-13,17-18H,7-11H2,1-6H3,(H,21,24)/p+1 |
| InChIKey | FKKUKHGYUXYDED-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|