C23H37N3S — CID 4564967
4-[methyl-(2-methylcyclohexyl)amino]-N-(2,4,6-trimethylphenyl)piperidine-1-carbothioamide (PubChem CID 4564967) has the molecular formula C23H37N3S and a molecular weight of 387.64 g/mol. Its IUPAC name is 4-[methyl-(2-methylcyclohexyl)amino]-N-(2,4,6-trimethylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[methyl-(2-methylcyclohexyl)amino]-N-(2,4,6-trimethylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 4564967 |
| Molecular Formula | C23H37N3S |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 4-[methyl-(2-methylcyclohexyl)amino]-N-(2,4,6-trimethylphenyl)piperidine-1-carbothioamide |
| SMILES | Cc1cc(C)c(NC(=S)N2CCC(N(C)C3CCCCC3C)CC2)c(C)c1 |
| InChI | InChI=1S/C23H37N3S/c1-16-14-18(3)22(19(4)15-16)24-23(27)26-12-10-20(11-13-26)25(5)21-9-7-6-8-17(21)2/h14-15,17,20-21H,6-13H2,1-5H3,(H,24,27) |
| InChIKey | LALVAULETQZLKL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|