C21H33N3S — CID 92696989
4-[methyl-[(1S,2R)-2-methylcyclohexyl]amino]-N-(4-methylphenyl)piperidine-1-carbothioamide (PubChem CID 92696989) has the molecular formula C21H33N3S and a molecular weight of 359.58 g/mol. Its IUPAC name is 4-[methyl-[(1S,2R)-2-methylcyclohexyl]amino]-N-(4-methylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[methyl-[(1S,2R)-2-methylcyclohexyl]amino]-N-(4-methylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 92696989 |
| Molecular Formula | C21H33N3S |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 4-[methyl-[(1S,2R)-2-methylcyclohexyl]amino]-N-(4-methylphenyl)piperidine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCC(N(C)[C@H]3CCCC[C@H]3C)CC2)cc1 |
| InChI | InChI=1S/C21H33N3S/c1-16-8-10-18(11-9-16)22-21(25)24-14-12-19(13-15-24)23(3)20-7-5-4-6-17(20)2/h8-11,17,19-20H,4-7,12-15H2,1-3H3,(H,22,25)/t17-,20+/m1/s1 |
| InChIKey | WWAQWSNTMGGDDV-XLIONFOSSA-N |
| XLogP | 4.67 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|