About cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium
cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium (PubChem CID 4250840) has the molecular formula C22H36N3S+
and a molecular weight of 374.62 g/mol. Its IUPAC name is cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium.
Molecular Properties
| Compound Name | cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
| PubChem CID | 4250840 |
| Molecular Formula | C22H36N3S+ |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
| SMILES | Cc1ccc(NC(=S)N2CCC([NH+](C)C3CCCCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H35N3S/c1-17-10-11-21(18(2)16-17)23-22(26)25-14-12-20(13-15-25)24(3)19-8-6-4-5-7-9-19/h10-11,16,19-20H,4-9,12-15H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | QQHKVHYPMUXCCT-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium?
The IUPAC name of cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium (CID 4250840) is cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium.
What is the SMILES notation for cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium?
The canonical SMILES for cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium is Cc1ccc(NC(=S)N2CCC([NH+](C)C3CCCCCC3)CC2)c(C)c1.
What is the InChIKey of cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium?
The InChIKey is QQHKVHYPMUXCCT-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H35N3S/c1-17-10-11-21(18(2)16-17)23-22(26)25-14-12-20(13-15-25)24(3)19-8-6-4-5-7-9-19/h10-11,16,19-20H,4-9,12-15H2,1-3H3,(H,23,26)/p+1.
What are the key properties of cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium?
cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium has a molecular weight of 374.62 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl-[1-[(2,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium is sourced from PubChem (CID 4250840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).