C22H36N3S+ — CID 4128648
[1-[(2-ethylphenyl)carbamothioyl]piperidin-4-yl]-methyl-(2-methylcyclohexyl)azanium (PubChem CID 4128648) has the molecular formula C22H36N3S+ and a molecular weight of 374.62 g/mol. Its IUPAC name is [1-[(2-ethylphenyl)carbamothioyl]piperidin-4-yl]-methyl-(2-methylcyclohexyl)azanium.
| Compound Name | [1-[(2-ethylphenyl)carbamothioyl]piperidin-4-yl]-methyl-(2-methylcyclohexyl)azanium |
|---|---|
| PubChem CID | 4128648 |
| Molecular Formula | C22H36N3S+ |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | [1-[(2-ethylphenyl)carbamothioyl]piperidin-4-yl]-methyl-(2-methylcyclohexyl)azanium |
| SMILES | CCc1ccccc1NC(=S)N1CCC([NH+](C)C2CCCCC2C)CC1 |
| InChI | InChI=1S/C22H35N3S/c1-4-18-10-6-7-11-20(18)23-22(26)25-15-13-19(14-16-25)24(3)21-12-8-5-9-17(21)2/h6-7,10-11,17,19,21H,4-5,8-9,12-16H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | FJNBWAUXMMDIAO-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|