C22H34N3O2S+ — CID 4122865
cyclohexyl-[1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium (PubChem CID 4122865) has the molecular formula C22H34N3O2S+ and a molecular weight of 404.60 g/mol. Its IUPAC name is cyclohexyl-[1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium.
| Compound Name | cyclohexyl-[1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
|---|---|
| PubChem CID | 4122865 |
| Molecular Formula | C22H34N3O2S+ |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | cyclohexyl-[1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
| SMILES | CCOC(=O)c1ccc(NC(=S)N2CCC([NH+](C)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O2S/c1-3-27-21(26)17-9-11-18(12-10-17)23-22(28)25-15-13-20(14-16-25)24(2)19-7-5-4-6-8-19/h9-12,19-20H,3-8,13-16H2,1-2H3,(H,23,28)/p+1 |
| InChIKey | PKPITBLYAOUYFE-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|