C21H34N3S+ — CID 5216675
cyclohexyl-[1-[(2,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium (PubChem CID 5216675) has the molecular formula C21H34N3S+ and a molecular weight of 360.59 g/mol. Its IUPAC name is cyclohexyl-[1-[(2,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium.
| Compound Name | cyclohexyl-[1-[(2,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
|---|---|
| PubChem CID | 5216675 |
| Molecular Formula | C21H34N3S+ |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | cyclohexyl-[1-[(2,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
| SMILES | Cc1ccc(C)c(NC(=S)N2CCC([NH+](C)C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C21H33N3S/c1-16-9-10-17(2)20(15-16)22-21(25)24-13-11-19(12-14-24)23(3)18-7-5-4-6-8-18/h9-10,15,18-19H,4-8,11-14H2,1-3H3,(H,22,25)/p+1 |
| InChIKey | BTGCMUPZDQJSAS-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|