C23H28N4S — CID 1430289
4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2,4-dimethylphenyl)piperidine-1-carbothioamide (PubChem CID 1430289) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2,4-dimethylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2,4-dimethylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 1430289 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2,4-dimethylphenyl)piperidine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCC(c3nc4cc(C)c(C)cc4[nH]3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H28N4S/c1-14-5-6-19(17(4)11-14)26-23(28)27-9-7-18(8-10-27)22-24-20-12-15(2)16(3)13-21(20)25-22/h5-6,11-13,18H,7-10H2,1-4H3,(H,24,25)(H,26,28) |
| InChIKey | KMMYCHIEURNMKW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|