C18H26N4OS — CID 5017850
4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)piperidine-1-carbothioamide (PubChem CID 5017850) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)piperidine-1-carbothioamide.
| Compound Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 5017850 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)piperidine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCC(c2nc3cc(C)c(C)cc3[nH]2)CC1 |
| InChI | InChI=1S/C18H26N4OS/c1-12-10-15-16(11-13(12)2)21-17(20-15)14-4-7-22(8-5-14)18(24)19-6-9-23-3/h10-11,14H,4-9H2,1-3H3,(H,19,24)(H,20,21) |
| InChIKey | BASOERHTOWHKBB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|