C21H23FN4S — CID 43815871
4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide (PubChem CID 43815871) has the molecular formula C21H23FN4S and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 43815871 |
| Molecular Formula | C21H23FN4S |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide |
| SMILES | Cc1cc2nc(C3CCN(C(=S)Nc4ccc(F)cc4)CC3)[nH]c2cc1C |
| InChI | InChI=1S/C21H23FN4S/c1-13-11-18-19(12-14(13)2)25-20(24-18)15-7-9-26(10-8-15)21(27)23-17-5-3-16(22)4-6-17/h3-6,11-12,15H,7-10H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | NZMQNTQLHHPPDG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|