C19H18Cl2N4S — CID 3223996
3-(6-chloro-1H-benzimidazol-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide (PubChem CID 3223996) has the molecular formula C19H18Cl2N4S and a molecular weight of 405.35 g/mol. Its IUPAC name is 3-(6-chloro-1H-benzimidazol-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide.
| Compound Name | 3-(6-chloro-1H-benzimidazol-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3223996 |
| Molecular Formula | C19H18Cl2N4S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3-(6-chloro-1H-benzimidazol-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)N1CCCC(c2nc3ccc(Cl)cc3[nH]2)C1 |
| InChI | InChI=1S/C19H18Cl2N4S/c20-13-3-6-15(7-4-13)22-19(26)25-9-1-2-12(11-25)18-23-16-8-5-14(21)10-17(16)24-18/h3-8,10,12H,1-2,9,11H2,(H,22,26)(H,23,24) |
| InChIKey | DESWBGPMHGCNMN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|