C21H23ClN4S — CID 3223903
N-(3-chlorophenyl)-3-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide (PubChem CID 3223903) has the molecular formula C21H23ClN4S and a molecular weight of 398.96 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-3-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3223903 |
| Molecular Formula | C21H23ClN4S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-(3-chlorophenyl)-3-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide |
| SMILES | Cc1cc2nc(C3CCCN(C(=S)Nc4cccc(Cl)c4)C3)[nH]c2cc1C |
| InChI | InChI=1S/C21H23ClN4S/c1-13-9-18-19(10-14(13)2)25-20(24-18)15-5-4-8-26(12-15)21(27)23-17-7-3-6-16(22)11-17/h3,6-7,9-11,15H,4-5,8,12H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | NRUMYGHRVOBUBN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|