C19H20ClN5S — CID 143370501
N-(3-chlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide (PubChem CID 143370501) has the molecular formula C19H20ClN5S and a molecular weight of 385.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 143370501 |
| Molecular Formula | C19H20ClN5S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(3-chlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1cccc(Cl)c1)N1CCCC(Nc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C19H20ClN5S/c20-14-3-1-4-15(10-14)23-19(26)25-8-2-5-17(12-25)22-16-6-7-18-13(9-16)11-21-24-18/h1,3-4,6-7,9-11,17,22H,2,5,8,12H2,(H,21,24)(H,23,26) |
| InChIKey | RALUMHMVQKWQDE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|