C17H18ClN7S — CID 162665118
N-(3-chlorophenyl)-4-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)piperidine-1-carbothioamide (PubChem CID 162665118) has the molecular formula C17H18ClN7S and a molecular weight of 387.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)piperidine-1-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-4-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 162665118 |
| Molecular Formula | C17H18ClN7S |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-(3-chlorophenyl)-4-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1cccc(Cl)c1)N1CCC(Nc2ncnc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C17H18ClN7S/c18-11-2-1-3-13(8-11)23-17(26)25-6-4-12(5-7-25)22-15-14-9-21-24-16(14)20-10-19-15/h1-3,8-10,12H,4-7H2,(H,23,26)(H2,19,20,21,22,24) |
| InChIKey | WYGSLCFDTOESHJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|