C19H19Cl2N5S — CID 143370496
N-(2,6-dichlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide (PubChem CID 143370496) has the molecular formula C19H19Cl2N5S and a molecular weight of 420.37 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide.
| Compound Name | N-(2,6-dichlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 143370496 |
| Molecular Formula | C19H19Cl2N5S |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3-(1H-indazol-5-ylamino)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1c(Cl)cccc1Cl)N1CCCC(Nc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C19H19Cl2N5S/c20-15-4-1-5-16(21)18(15)24-19(27)26-8-2-3-14(11-26)23-13-6-7-17-12(9-13)10-22-25-17/h1,4-7,9-10,14,23H,2-3,8,11H2,(H,22,25)(H,24,27) |
| InChIKey | JLVYVZVKZNSJNK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|