C17H19ClN7O- — CID 143370615
N-[1-[4-chloro-6-methyl-5-(oxidoamino)pyrimidin-2-yl]piperidin-3-yl]-1H-indazol-5-amine (PubChem CID 143370615) has the molecular formula C17H19ClN7O- and a molecular weight of 372.84 g/mol. Its IUPAC name is N-[1-[4-chloro-6-methyl-5-(oxidoamino)pyrimidin-2-yl]piperidin-3-yl]-1H-indazol-5-amine.
| Compound Name | N-[1-[4-chloro-6-methyl-5-(oxidoamino)pyrimidin-2-yl]piperidin-3-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 143370615 |
| Molecular Formula | C17H19ClN7O- |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[1-[4-chloro-6-methyl-5-(oxidoamino)pyrimidin-2-yl]piperidin-3-yl]-1H-indazol-5-amine |
| SMILES | Cc1nc(N2CCCC(Nc3ccc4[nH]ncc4c3)C2)nc(Cl)c1N[O-] |
| InChI | InChI=1S/C17H19ClN7O/c1-10-15(24-26)16(18)22-17(20-10)25-6-2-3-13(9-25)21-12-4-5-14-11(7-12)8-19-23-14/h4-5,7-8,13,21,24H,2-3,6,9H2,1H3,(H,19,23)/q-1 |
| InChIKey | GNKSWCKSNVHAJM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|