C17H18N8 — CID 143370599
4-amino-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 143370599) has the molecular formula C17H18N8 and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-amino-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 143370599 |
| Molecular Formula | C17H18N8 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 4-amino-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(N2CCCC(Nc3ccc4[nH]ncc4c3)C2)nc1N |
| InChI | InChI=1S/C17H18N8/c18-7-12-8-20-17(23-16(12)19)25-5-1-2-14(10-25)22-13-3-4-15-11(6-13)9-21-24-15/h3-4,6,8-9,14,22H,1-2,5,10H2,(H,21,24)(H2,19,20,23) |
| InChIKey | VLDMVCBISLKMTH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |