C18H18Cl2N4 — CID 143370604
N-[1-(2,4-dichlorophenyl)piperidin-3-yl]-1H-indazol-6-amine (PubChem CID 143370604) has the molecular formula C18H18Cl2N4 and a molecular weight of 361.28 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)piperidin-3-yl]-1H-indazol-6-amine.
| Compound Name | N-[1-(2,4-dichlorophenyl)piperidin-3-yl]-1H-indazol-6-amine |
|---|---|
| PubChem CID | 143370604 |
| Molecular Formula | C18H18Cl2N4 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)piperidin-3-yl]-1H-indazol-6-amine |
| SMILES | Clc1ccc(N2CCCC(Nc3ccc4cn[nH]c4c3)C2)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N4/c19-13-4-6-18(16(20)8-13)24-7-1-2-15(11-24)22-14-5-3-12-10-21-23-17(12)9-14/h3-6,8-10,15,22H,1-2,7,11H2,(H,21,23) |
| InChIKey | XRVDCIZNLMOVPX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |