C20H28N4S — CID 3223963
N-cyclohexyl-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide (PubChem CID 3223963) has the molecular formula C20H28N4S and a molecular weight of 356.54 g/mol. Its IUPAC name is N-cyclohexyl-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide.
| Compound Name | N-cyclohexyl-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3223963 |
| Molecular Formula | C20H28N4S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-cyclohexyl-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbothioamide |
| SMILES | Cc1ccc2nc(C3CCCN(C(=S)NC4CCCCC4)C3)[nH]c2c1 |
| InChI | InChI=1S/C20H28N4S/c1-14-9-10-17-18(12-14)23-19(22-17)15-6-5-11-24(13-15)20(25)21-16-7-3-2-4-8-16/h9-10,12,15-16H,2-8,11,13H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | LFERGQXFGRRFBG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|