C20H23FN3OS+ — CID 7470287
N-(4-acetylphenyl)-4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 7470287) has the molecular formula C20H23FN3OS+ and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(4-acetylphenyl)-4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7470287 |
| Molecular Formula | C20H23FN3OS+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-(4-acetylphenyl)-4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | CC(=O)c1ccc(NC(=S)N2CC[NH+](Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H22FN3OS/c1-15(25)17-4-8-19(9-5-17)22-20(26)24-12-10-23(11-13-24)14-16-2-6-18(21)7-3-16/h2-9H,10-14H2,1H3,(H,22,26)/p+1 |
| InChIKey | SKYXEAMWGMDEAK-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|