C21H26N3OS+ — CID 2712621
N-(3-acetylphenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 2712621) has the molecular formula C21H26N3OS+ and a molecular weight of 368.53 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(3-acetylphenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 2712621 |
| Molecular Formula | C21H26N3OS+ |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-(3-acetylphenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | CC(=O)c1cccc(NC(=S)N2CC[NH+](CCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3OS/c1-17(25)19-8-5-9-20(16-19)22-21(26)24-14-12-23(13-15-24)11-10-18-6-3-2-4-7-18/h2-9,16H,10-15H2,1H3,(H,22,26)/p+1 |
| InChIKey | HRMUJPAUDKVABR-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|