C18H24N3OS+ — CID 7346663
N-(furan-2-ylmethyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 7346663) has the molecular formula C18H24N3OS+ and a molecular weight of 330.48 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7346663 |
| Molecular Formula | C18H24N3OS+ |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(2-phenylethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | S=C(NCc1ccco1)N1CC[NH+](CCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H23N3OS/c23-18(19-15-17-7-4-14-22-17)21-12-10-20(11-13-21)9-8-16-5-2-1-3-6-16/h1-7,14H,8-13,15H2,(H,19,23)/p+1 |
| InChIKey | HZPOOOWLUHUABG-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 32.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|