C15H20N3OS2+ — CID 8564956
N-(furan-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 8564956) has the molecular formula C15H20N3OS2+ and a molecular weight of 322.48 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8564956 |
| Molecular Formula | C15H20N3OS2+ |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | S=C(NCc1ccco1)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C15H19N3OS2/c20-15(16-10-14-2-1-8-19-14)18-6-4-17(5-7-18)11-13-3-9-21-12-13/h1-3,8-9,12H,4-7,10-11H2,(H,16,20)/p+1 |
| InChIKey | BASNZXPYGXWUFO-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 32.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|