C15H19N3O2S — CID 859016
N,4-bis(furan-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 859016) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N,4-bis(furan-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | N,4-bis(furan-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 859016 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N,4-bis(furan-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | S=C(NCc1ccco1)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C15H19N3O2S/c21-15(16-11-13-3-1-9-19-13)18-7-5-17(6-8-18)12-14-4-2-10-20-14/h1-4,9-10H,5-8,11-12H2,(H,16,21) |
| InChIKey | CSGDPWMBRJTAGS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|