C20H27N3O3S2 — CID 7944131
N-(furan-2-ylmethyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 7944131) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 7944131 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=S)NCc3ccco3)CC2)c1C |
| InChI | InChI=1S/C20H27N3O3S2/c1-14-12-15(2)17(4)19(16(14)3)28(24,25)23-9-7-22(8-10-23)20(27)21-13-18-6-5-11-26-18/h5-6,11-12H,7-10,13H2,1-4H3,(H,21,27) |
| InChIKey | SGFZOZAMQUPHBF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|