C15H18N4O5S2 — CID 43076327
5-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonylfuran-2-carboxamide (PubChem CID 43076327) has the molecular formula C15H18N4O5S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 5-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonylfuran-2-carboxamide.
| Compound Name | 5-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 43076327 |
| Molecular Formula | C15H18N4O5S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 5-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2CCN(C(=S)NCc3ccco3)CC2)o1 |
| InChI | InChI=1S/C15H18N4O5S2/c16-14(20)12-3-4-13(24-12)26(21,22)19-7-5-18(6-8-19)15(25)17-10-11-2-1-9-23-11/h1-4,9H,5-8,10H2,(H2,16,20)(H,17,25) |
| InChIKey | OIRPSUNRDLTJJL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|