C18H23N3O6S2 — CID 43076372
methyl 4-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate (PubChem CID 43076372) has the molecular formula C18H23N3O6S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is methyl 4-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate.
| Compound Name | methyl 4-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43076372 |
| Molecular Formula | C18H23N3O6S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | methyl 4-[4-(furan-2-ylmethylcarbamothioyl)piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(C)c1S(=O)(=O)N1CCN(C(=S)NCc2ccco2)CC1 |
| InChI | InChI=1S/C18H23N3O6S2/c1-12-15(17(22)25-3)16(13(2)27-12)29(23,24)21-8-6-20(7-9-21)18(28)19-11-14-5-4-10-26-14/h4-5,10H,6-9,11H2,1-3H3,(H,19,28) |
| InChIKey | GKFKMZRAZBJNHN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|