C16H23N3O5S2 — CID 43076403
methyl 2,5-dimethyl-4-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]sulfonylfuran-3-carboxylate (PubChem CID 43076403) has the molecular formula C16H23N3O5S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]sulfonylfuran-3-carboxylate.
| Compound Name | methyl 2,5-dimethyl-4-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]sulfonylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43076403 |
| Molecular Formula | C16H23N3O5S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | methyl 2,5-dimethyl-4-[4-(prop-2-enylcarbamothioyl)piperazin-1-yl]sulfonylfuran-3-carboxylate |
| SMILES | C=CCNC(=S)N1CCN(S(=O)(=O)c2c(C)oc(C)c2C(=O)OC)CC1 |
| InChI | InChI=1S/C16H23N3O5S2/c1-5-6-17-16(25)18-7-9-19(10-8-18)26(21,22)14-12(3)24-11(2)13(14)15(20)23-4/h5H,1,6-10H2,2-4H3,(H,17,25) |
| InChIKey | WYMZVCJTRHHWLG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|