C20H24FN3O5S2 — CID 43076361
methyl 4-[4-[(4-fluorophenyl)methylcarbamothioyl]piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate (PubChem CID 43076361) has the molecular formula C20H24FN3O5S2 and a molecular weight of 469.56 g/mol. Its IUPAC name is methyl 4-[4-[(4-fluorophenyl)methylcarbamothioyl]piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate.
| Compound Name | methyl 4-[4-[(4-fluorophenyl)methylcarbamothioyl]piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43076361 |
| Molecular Formula | C20H24FN3O5S2 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | methyl 4-[4-[(4-fluorophenyl)methylcarbamothioyl]piperazin-1-yl]sulfonyl-2,5-dimethylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(C)c1S(=O)(=O)N1CCN(C(=S)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H24FN3O5S2/c1-13-17(19(25)28-3)18(14(2)29-13)31(26,27)24-10-8-23(9-11-24)20(30)22-12-15-4-6-16(21)7-5-15/h4-7H,8-12H2,1-3H3,(H,22,30) |
| InChIKey | YNVDTBBAVLJCCK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|