C20H25N3O5S2 — CID 43076397
methyl 2,5-dimethyl-4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylfuran-3-carboxylate (PubChem CID 43076397) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylfuran-3-carboxylate.
| Compound Name | methyl 2,5-dimethyl-4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43076397 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | methyl 2,5-dimethyl-4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(C)c1S(=O)(=O)N1CCN(C(=S)Nc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-13-5-7-16(8-6-13)21-20(29)22-9-11-23(12-10-22)30(25,26)18-15(3)28-14(2)17(18)19(24)27-4/h5-8H,9-12H2,1-4H3,(H,21,29) |
| InChIKey | VETXXKNQOLVEAT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|