C19H22N4O3S2 — CID 9241256
4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylbenzamide (PubChem CID 9241256) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylbenzamide.
| Compound Name | 4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 9241256 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[4-[(4-methylphenyl)carbamothioyl]piperazin-1-yl]sulfonylbenzamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(S(=O)(=O)c3ccc(C(N)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O3S2/c1-14-2-6-16(7-3-14)21-19(27)22-10-12-23(13-11-22)28(25,26)17-8-4-15(5-9-17)18(20)24/h2-9H,10-13H2,1H3,(H2,20,24)(H,21,27) |
| InChIKey | XSGBUYJEPFWFKG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|