C16H24N4O3S2 — CID 17271594
4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)piperazine-1-carbothioamide (PubChem CID 17271594) has the molecular formula C16H24N4O3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17271594 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C16H24N4O3S2/c1-18-6-8-19(9-7-18)16(24)17-14-2-4-15(5-3-14)25(21,22)20-10-12-23-13-11-20/h2-5H,6-13H2,1H3,(H,17,24) |
| InChIKey | OPESSCJGKWHKLD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|