C14H21N3O4S2 — CID 23993998
1-(2-hydroxyethyl)-1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 23993998) has the molecular formula C14H21N3O4S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(2-hydroxyethyl)-1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 23993998 |
| Molecular Formula | C14H21N3O4S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | CN(CCO)C(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H21N3O4S2/c1-16(6-9-18)14(22)15-12-2-4-13(5-3-12)23(19,20)17-7-10-21-11-8-17/h2-5,18H,6-11H2,1H3,(H,15,22) |
| InChIKey | QITJLFZHRICFFJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|